C23H32Cl3N3O2 — CID 129318847
4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N,N-diethylpentan-1-amine oxide;dihydrochloride (PubChem CID 129318847) has the molecular formula C23H32Cl3N3O2 and a molecular weight of 488.89 g/mol. Its IUPAC name is 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N,N-diethylpentan-1-amine oxide;dihydrochloride.
| Compound Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N,N-diethylpentan-1-amine oxide;dihydrochloride |
|---|---|
| PubChem CID | 129318847 |
| Molecular Formula | C23H32Cl3N3O2 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N,N-diethylpentan-1-amine oxide;dihydrochloride |
| SMILES | CC[N+]([O-])(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12.Cl.Cl |
| InChI | InChI=1S/C23H30ClN3O2.2ClH/c1-5-27(28,6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(29-4)15-20(21)23;;/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);2*1H |
| InChIKey | QOTUTSYVHITUCE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 57.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|