C25H34ClN3 — CID 176557691
4-N-(6-chloro-2-ethylacridin-9-yl)-1-N-ethyl-1-N-propylpentane-1,4-diamine (PubChem CID 176557691) has the molecular formula C25H34ClN3 and a molecular weight of 412.02 g/mol. Its IUPAC name is 4-N-(6-chloro-2-ethylacridin-9-yl)-1-N-ethyl-1-N-propylpentane-1,4-diamine.
| Compound Name | 4-N-(6-chloro-2-ethylacridin-9-yl)-1-N-ethyl-1-N-propylpentane-1,4-diamine |
|---|---|
| PubChem CID | 176557691 |
| Molecular Formula | C25H34ClN3 |
| Molecular Weight | 412.02 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-N-(6-chloro-2-ethylacridin-9-yl)-1-N-ethyl-1-N-propylpentane-1,4-diamine |
| SMILES | CCCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(CC)cc12 |
| InChI | InChI=1S/C25H34ClN3/c1-5-14-29(7-3)15-8-9-18(4)27-25-21-12-11-20(26)17-24(21)28-23-13-10-19(6-2)16-22(23)25/h10-13,16-18H,5-9,14-15H2,1-4H3,(H,27,28) |
| InChIKey | XWHYRCVVFGDFSV-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.02 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|