C10H18ClN3S — CID 106117349
N-[2-(2-chloroethyl)pentyl]-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 106117349) has the molecular formula C10H18ClN3S and a molecular weight of 247.79 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-5-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-5-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 106117349 |
| Molecular Formula | C10H18ClN3S |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCC(CCCl)CNc1nnc(C)s1 |
| InChI | InChI=1S/C10H18ClN3S/c1-3-4-9(5-6-11)7-12-10-14-13-8(2)15-10/h9H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | ZOCMHSHFCYEHOA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|