C11H21N3S — CID 103729148
5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine (PubChem CID 103729148) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103729148 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCC(CCC)Nc1nnc(C)s1 |
| InChI | InChI=1S/C11H21N3S/c1-4-6-8-10(7-5-2)12-11-14-13-9(3)15-11/h10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | KYWJVKHYTXXLOA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |