About 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine
5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine (PubChem CID 103729148) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 103729148 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCC(CCC)Nc1nnc(C)s1 |
| InChI | InChI=1S/C11H21N3S/c1-4-6-8-10(7-5-2)12-11-14-13-9(3)15-11/h10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | KYWJVKHYTXXLOA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine (CID 103729148) is 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine is CCCCC(CCC)Nc1nnc(C)s1.
What is the InChIKey of 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine?
The InChIKey is KYWJVKHYTXXLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-4-6-8-10(7-5-2)12-11-14-13-9(3)15-11/h10H,4-8H2,1-3H3,(H,12,14).
What are the key properties of 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine?
5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine has a molecular weight of 227.38 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-octan-4-yl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 103729148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).