C13H25N3S — CID 106026374
N-octan-4-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 106026374) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-octan-4-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-octan-4-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 106026374 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-octan-4-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CCCCC(CCC)Nc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C13H25N3S/c1-5-7-9-11(8-6-2)14-13-15-12(10(3)4)16-17-13/h10-11H,5-9H2,1-4H3,(H,14,15,16) |
| InChIKey | CZNOLDZGQUPUIZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |