C10H15N3S — CID 115681108
N-pent-4-yn-2-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 115681108) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is N-pent-4-yn-2-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-pent-4-yn-2-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 115681108 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-pent-4-yn-2-yl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | C#CCC(C)Nc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C10H15N3S/c1-5-6-8(4)11-10-12-9(7(2)3)13-14-10/h1,7-8H,6H2,2-4H3,(H,11,12,13) |
| InChIKey | AOJPALIFQNECBE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|