C14H24ClN3OS — CID 106117745
4-tert-butyl-N-[2-(2-chloroethyl)pentyl]thiadiazole-5-carboxamide (PubChem CID 106117745) has the molecular formula C14H24ClN3OS and a molecular weight of 317.89 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2-chloroethyl)pentyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[2-(2-chloroethyl)pentyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106117745 |
| Molecular Formula | C14H24ClN3OS |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-tert-butyl-N-[2-(2-chloroethyl)pentyl]thiadiazole-5-carboxamide |
| SMILES | CCCC(CCCl)CNC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C14H24ClN3OS/c1-5-6-10(7-8-15)9-16-13(19)11-12(14(2,3)4)17-18-20-11/h10H,5-9H2,1-4H3,(H,16,19) |
| InChIKey | PCIIOOQJZOVMEN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|