C12H21N3O3S — CID 107866649
4-tert-butyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]thiadiazole-5-carboxamide (PubChem CID 107866649) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107866649 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-tert-butyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]thiadiazole-5-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C12H21N3O3S/c1-5-12(6-16,7-17)13-10(18)8-9(11(2,3)4)14-15-19-8/h16-17H,5-7H2,1-4H3,(H,13,18) |
| InChIKey | IMRVZFBWIDOLGY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |