C12H19Br2N3OS — CID 107868164
N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-tert-butylthiadiazole-5-carboxamide (PubChem CID 107868164) has the molecular formula C12H19Br2N3OS and a molecular weight of 413.18 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-tert-butylthiadiazole-5-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-tert-butylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107868164 |
| Molecular Formula | C12H19Br2N3OS |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-tert-butylthiadiazole-5-carboxamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C12H19Br2N3OS/c1-5-12(6-13,7-14)15-10(18)8-9(11(2,3)4)16-17-19-8/h5-7H2,1-4H3,(H,15,18) |
| InChIKey | RCXMUSQVTSIJCN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|