C13H21N3O3S — CID 65205797
4-[(4-tert-butylthiadiazole-5-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 65205797) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[(4-tert-butylthiadiazole-5-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(4-tert-butylthiadiazole-5-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 65205797 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[(4-tert-butylthiadiazole-5-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C13H21N3O3S/c1-12(2,3)10-9(20-16-15-10)11(19)14-13(4,5)7-6-8(17)18/h6-7H2,1-5H3,(H,14,19)(H,17,18) |
| InChIKey | MSJKGDMEMUEEIV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |