C13H23N3O3S — CID 106512254
4-tert-butyl-N-(2-hydroxy-4-methoxy-2-methylbutyl)thiadiazole-5-carboxamide (PubChem CID 106512254) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-hydroxy-4-methoxy-2-methylbutyl)thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-(2-hydroxy-4-methoxy-2-methylbutyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106512254 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-tert-butyl-N-(2-hydroxy-4-methoxy-2-methylbutyl)thiadiazole-5-carboxamide |
| SMILES | COCCC(C)(O)CNC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C13H23N3O3S/c1-12(2,3)10-9(20-16-15-10)11(17)14-8-13(4,18)6-7-19-5/h18H,6-8H2,1-5H3,(H,14,17) |
| InChIKey | VRYRMJADCFLYCW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |