C11H18BrN3OS — CID 106845798
N-(4-bromobutyl)-4-tert-butylthiadiazole-5-carboxamide (PubChem CID 106845798) has the molecular formula C11H18BrN3OS and a molecular weight of 320.26 g/mol. Its IUPAC name is N-(4-bromobutyl)-4-tert-butylthiadiazole-5-carboxamide.
| Compound Name | N-(4-bromobutyl)-4-tert-butylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106845798 |
| Molecular Formula | C11H18BrN3OS |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(4-bromobutyl)-4-tert-butylthiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NCCCCBr |
| InChI | InChI=1S/C11H18BrN3OS/c1-11(2,3)9-8(17-15-14-9)10(16)13-7-5-4-6-12/h4-7H2,1-3H3,(H,13,16) |
| InChIKey | AEWNOGLIZZPHBE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|