C11H18N4OS2 — CID 65205324
N-(4-amino-4-sulfanylidenebutyl)-4-tert-butylthiadiazole-5-carboxamide (PubChem CID 65205324) has the molecular formula C11H18N4OS2 and a molecular weight of 286.43 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutyl)-4-tert-butylthiadiazole-5-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutyl)-4-tert-butylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65205324 |
| Molecular Formula | C11H18N4OS2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutyl)-4-tert-butylthiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NCCCC(N)=S |
| InChI | InChI=1S/C11H18N4OS2/c1-11(2,3)9-8(18-15-14-9)10(16)13-6-4-5-7(12)17/h4-6H2,1-3H3,(H2,12,17)(H,13,16) |
| InChIKey | PZRNYTIPBHKJGE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|