C14H24N2OS — CID 114210800
1-(4-tert-butylthiadiazol-5-yl)-5,5-dimethylhexan-1-one (PubChem CID 114210800) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 1-(4-tert-butylthiadiazol-5-yl)-5,5-dimethylhexan-1-one.
| Compound Name | 1-(4-tert-butylthiadiazol-5-yl)-5,5-dimethylhexan-1-one |
|---|---|
| PubChem CID | 114210800 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(4-tert-butylthiadiazol-5-yl)-5,5-dimethylhexan-1-one |
| SMILES | CC(C)(C)CCCC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C14H24N2OS/c1-13(2,3)9-7-8-10(17)11-12(14(4,5)6)15-16-18-11/h7-9H2,1-6H3 |
| InChIKey | SBZZBJMXUHHLSG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |