C11H17Br2N3OS — CID 107868025
N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 107868025) has the molecular formula C11H17Br2N3OS and a molecular weight of 399.15 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 107868025 |
| Molecular Formula | C11H17Br2N3OS |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1snnc1C(C)C |
| InChI | InChI=1S/C11H17Br2N3OS/c1-4-11(5-12,6-13)14-10(17)9-8(7(2)3)15-16-18-9/h7H,4-6H2,1-3H3,(H,14,17) |
| InChIKey | BNZQUPBJUUNURG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|