C10H18N4OS — CID 63888965
N-[3-(aminomethyl)pentan-3-yl]-4-methylthiadiazole-5-carboxamide (PubChem CID 63888965) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 63888965 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-methylthiadiazole-5-carboxamide |
| SMILES | CCC(CC)(CN)NC(=O)c1snnc1C |
| InChI | InChI=1S/C10H18N4OS/c1-4-10(5-2,6-11)12-9(15)8-7(3)13-14-16-8/h4-6,11H2,1-3H3,(H,12,15) |
| InChIKey | JMIIFZPKGUBFCG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |