About N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide
N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 115310439) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide |
| PubChem CID | 115310439 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC(C)(CN)C(C)C |
| InChI | InChI=1S/C10H18N4OS/c1-6(2)10(4,5-11)12-9(15)8-7(3)13-14-16-8/h6H,5,11H2,1-4H3,(H,12,15) |
| InChIKey | NWTVVMYENCFRSS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide?
The IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide (CID 115310439) is N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide.
What is the SMILES notation for N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide?
The canonical SMILES for N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide is Cc1nnsc1C(=O)NC(C)(CN)C(C)C.
What is the InChIKey of N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide?
The InChIKey is NWTVVMYENCFRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-6(2)10(4,5-11)12-9(15)8-7(3)13-14-16-8/h6H,5,11H2,1-4H3,(H,12,15).
What are the key properties of N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide?
N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide has a molecular weight of 242.35 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,3-dimethylbutan-2-yl)-4-methylthiadiazole-5-carboxamide is sourced from PubChem (CID 115310439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).