C10H15N3O3S — CID 65220608
3-methyl-2-[[(4-methylthiadiazole-5-carbonyl)amino]methyl]butanoic acid (PubChem CID 65220608) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-methyl-2-[[(4-methylthiadiazole-5-carbonyl)amino]methyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(4-methylthiadiazole-5-carbonyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65220608 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-methyl-2-[[(4-methylthiadiazole-5-carbonyl)amino]methyl]butanoic acid |
| SMILES | Cc1nnsc1C(=O)NCC(C(=O)O)C(C)C |
| InChI | InChI=1S/C10H15N3O3S/c1-5(2)7(10(15)16)4-11-9(14)8-6(3)12-13-17-8/h5,7H,4H2,1-3H3,(H,11,14)(H,15,16) |
| InChIKey | RIYBORBFZIIZOQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |