C6H9N3OS — CID 60660728
N-ethyl-4-methylthiadiazole-5-carboxamide (PubChem CID 60660728) has the molecular formula C6H9N3OS and a molecular weight of 171.22 g/mol. Its IUPAC name is N-ethyl-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-ethyl-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 60660728 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N-ethyl-4-methylthiadiazole-5-carboxamide |
| SMILES | CCNC(=O)c1snnc1C |
| InChI | InChI=1S/C6H9N3OS/c1-3-7-6(10)5-4(2)8-9-11-5/h3H2,1-2H3,(H,7,10) |
| InChIKey | FLLKUZMLSQMUKW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |