C8H14N4OS — CID 43600601
4-methyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide (PubChem CID 43600601) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 4-methyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 43600601 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-methyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide |
| SMILES | CNCCCNC(=O)c1snnc1C |
| InChI | InChI=1S/C8H14N4OS/c1-6-7(14-12-11-6)8(13)10-5-3-4-9-2/h9H,3-5H2,1-2H3,(H,10,13) |
| InChIKey | FVUHQKZBCBPPGW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|