C9H16N4OS — CID 65210223
4-ethyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide (PubChem CID 65210223) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 4-ethyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65210223 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-ethyl-N-[3-(methylamino)propyl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCCCNC |
| InChI | InChI=1S/C9H16N4OS/c1-3-7-8(15-13-12-7)9(14)11-6-4-5-10-2/h10H,3-6H2,1-2H3,(H,11,14) |
| InChIKey | RRRVENWXEYHBGJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|