C11H17N3O3S — CID 113440692
5-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpentanoic acid (PubChem CID 113440692) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpentanoic acid.
| Compound Name | 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 113440692 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-[(4-ethylthiadiazole-5-carbonyl)amino]-2-methylpentanoic acid |
| SMILES | CCc1nnsc1C(=O)NCCCC(C)C(=O)O |
| InChI | InChI=1S/C11H17N3O3S/c1-3-8-9(18-14-13-8)10(15)12-6-4-5-7(2)11(16)17/h7H,3-6H2,1-2H3,(H,12,15)(H,16,17) |
| InChIKey | CGJPSTLAMCMLPA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|