C13H20N4O4S — CID 120694717
(2S)-2-[[2-[(4-ethylthiadiazole-5-carbonyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 120694717) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-ethylthiadiazole-5-carbonyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[2-[(4-ethylthiadiazole-5-carbonyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120694717 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (2S)-2-[[2-[(4-ethylthiadiazole-5-carbonyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CCc1nnsc1C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H20N4O4S/c1-4-8-11(22-17-16-8)12(19)14-6-10(18)15-9(13(20)21)5-7(2)3/h7,9H,4-6H2,1-3H3,(H,14,19)(H,15,18)(H,20,21)/t9-/m0/s1 |
| InChIKey | GRZYWSSHLAAMOX-VIFPVBQESA-N |
| XLogP | 0.45 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |