C15H24N4O4 — CID 120695177
(2S)-4-methyl-2-[[2-[(1-propylpyrazole-4-carbonyl)amino]acetyl]amino]pentanoic acid (PubChem CID 120695177) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-[(1-propylpyrazole-4-carbonyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-[(1-propylpyrazole-4-carbonyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120695177 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2S)-4-methyl-2-[[2-[(1-propylpyrazole-4-carbonyl)amino]acetyl]amino]pentanoic acid |
| SMILES | CCCn1cc(C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)O)cn1 |
| InChI | InChI=1S/C15H24N4O4/c1-4-5-19-9-11(7-17-19)14(21)16-8-13(20)18-12(15(22)23)6-10(2)3/h7,9-10,12H,4-6,8H2,1-3H3,(H,16,21)(H,18,20)(H,22,23)/t12-/m0/s1 |
| InChIKey | MKUYTUBNNGEJNX-LBPRGKRZSA-N |
| XLogP | 0.64 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |