C11H16N4O4S — CID 120695799
(2S)-4-methyl-2-[[2-(thiadiazole-5-carbonylamino)acetyl]amino]pentanoic acid (PubChem CID 120695799) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-(thiadiazole-5-carbonylamino)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-(thiadiazole-5-carbonylamino)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120695799 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2S)-4-methyl-2-[[2-(thiadiazole-5-carbonylamino)acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cnns1)C(=O)O |
| InChI | InChI=1S/C11H16N4O4S/c1-6(2)3-7(11(18)19)14-9(16)5-12-10(17)8-4-13-15-20-8/h4,6-7H,3,5H2,1-2H3,(H,12,17)(H,14,16)(H,18,19)/t7-/m0/s1 |
| InChIKey | FGAZGRHUKZWSSB-ZETCQYMHSA-N |
| XLogP | -0.12 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |