C13H20N4O4 — CID 120694502
(2S)-4-methyl-2-[[2-[(2-methylpyrazole-3-carbonyl)amino]acetyl]amino]pentanoic acid (PubChem CID 120694502) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-[(2-methylpyrazole-3-carbonyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-[(2-methylpyrazole-3-carbonyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120694502 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2S)-4-methyl-2-[[2-[(2-methylpyrazole-3-carbonyl)amino]acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1ccnn1C)C(=O)O |
| InChI | InChI=1S/C13H20N4O4/c1-8(2)6-9(13(20)21)16-11(18)7-14-12(19)10-4-5-15-17(10)3/h4-5,8-9H,6-7H2,1-3H3,(H,14,19)(H,16,18)(H,20,21)/t9-/m0/s1 |
| InChIKey | VEVBOUWZTWWWDO-VIFPVBQESA-N |
| XLogP | -0.23 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |