C8H11N3O4S — CID 65206273
(2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 65206273) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 65206273 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (2S)-2-[(4-ethylthiadiazole-5-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | CCc1nnsc1C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H11N3O4S/c1-2-4-6(16-11-10-4)7(13)9-5(3-12)8(14)15/h5,12H,2-3H2,1H3,(H,9,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | JIGDAGKEUSQXCW-YFKPBYRVSA-N |
| XLogP | -0.72 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |