C10H14N4O4S — CID 114004767
(2R)-4-amino-4-oxo-2-[(4-propylthiadiazole-5-carbonyl)amino]butanoic acid (PubChem CID 114004767) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-[(4-propylthiadiazole-5-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-[(4-propylthiadiazole-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114004767 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-[(4-propylthiadiazole-5-carbonyl)amino]butanoic acid |
| SMILES | CCCc1nnsc1C(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H14N4O4S/c1-2-3-5-8(19-14-13-5)9(16)12-6(10(17)18)4-7(11)15/h6H,2-4H2,1H3,(H2,11,15)(H,12,16)(H,17,18)/t6-/m1/s1 |
| InChIKey | FMVZRBYNYJRYDI-ZCFIWIBFSA-N |
| XLogP | -0.45 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |