C10H14N4OS — CID 65204910
N-(1-cyanopropyl)-4-propylthiadiazole-5-carboxamide (PubChem CID 65204910) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is N-(1-cyanopropyl)-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-(1-cyanopropyl)-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204910 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-(1-cyanopropyl)-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NC(C#N)CC |
| InChI | InChI=1S/C10H14N4OS/c1-3-5-8-9(16-14-13-8)10(15)12-7(4-2)6-11/h7H,3-5H2,1-2H3,(H,12,15) |
| InChIKey | MXPMATBWQMGERA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |