C11H18ClN3OS — CID 114305945
N-(5-chloropentan-2-yl)-4-propylthiadiazole-5-carboxamide (PubChem CID 114305945) has the molecular formula C11H18ClN3OS and a molecular weight of 275.81 g/mol. Its IUPAC name is N-(5-chloropentan-2-yl)-4-propylthiadiazole-5-carboxamide.
| Compound Name | N-(5-chloropentan-2-yl)-4-propylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 114305945 |
| Molecular Formula | C11H18ClN3OS |
| Molecular Weight | 275.81 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(5-chloropentan-2-yl)-4-propylthiadiazole-5-carboxamide |
| SMILES | CCCc1nnsc1C(=O)NC(C)CCCCl |
| InChI | InChI=1S/C11H18ClN3OS/c1-3-5-9-10(17-15-14-9)11(16)13-8(2)6-4-7-12/h8H,3-7H2,1-2H3,(H,13,16) |
| InChIKey | MCIWJFPQEBTING-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|