C9H14N4OS2 — CID 65198611
N-(1-amino-3-methyl-1-sulfanylidenebutan-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 65198611) has the molecular formula C9H14N4OS2 and a molecular weight of 258.37 g/mol. Its IUPAC name is N-(1-amino-3-methyl-1-sulfanylidenebutan-2-yl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(1-amino-3-methyl-1-sulfanylidenebutan-2-yl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65198611 |
| Molecular Formula | C9H14N4OS2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(1-amino-3-methyl-1-sulfanylidenebutan-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC(C(N)=S)C(C)C |
| InChI | InChI=1S/C9H14N4OS2/c1-4(2)6(8(10)15)11-9(14)7-5(3)12-13-16-7/h4,6H,1-3H3,(H2,10,15)(H,11,14) |
| InChIKey | VLKPTWNBFSDFCX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|