C12H19N3O3S — CID 65206035
(2S)-2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 65206035) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is (2S)-2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 65206035 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2S)-2-[(4-tert-butylthiadiazole-5-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1snnc1C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H19N3O3S/c1-6(2)7(11(17)18)13-10(16)8-9(12(3,4)5)14-15-19-8/h6-7H,1-5H3,(H,13,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | AHRFUMCXYBNVHF-ZETCQYMHSA-N |
| XLogP | 1.67 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |