C12H17N5OS — CID 106512263
4-tert-butyl-N-[1-(1H-pyrazol-4-yl)ethyl]thiadiazole-5-carboxamide (PubChem CID 106512263) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(1H-pyrazol-4-yl)ethyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[1-(1H-pyrazol-4-yl)ethyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106512263 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-tert-butyl-N-[1-(1H-pyrazol-4-yl)ethyl]thiadiazole-5-carboxamide |
| SMILES | CC(NC(=O)c1snnc1C(C)(C)C)c1cn[nH]c1 |
| InChI | InChI=1S/C12H17N5OS/c1-7(8-5-13-14-6-8)15-11(18)9-10(12(2,3)4)16-17-19-9/h5-7H,1-4H3,(H,13,14)(H,15,18) |
| InChIKey | OKJPITMOIOGQES-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |