C21H24N4OS — CID 99792709
4-tert-butyl-N-[4-[[(1R)-1-phenylethyl]amino]phenyl]thiadiazole-5-carboxamide (PubChem CID 99792709) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[(1R)-1-phenylethyl]amino]phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[4-[[(1R)-1-phenylethyl]amino]phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 99792709 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-tert-butyl-N-[4-[[(1R)-1-phenylethyl]amino]phenyl]thiadiazole-5-carboxamide |
| SMILES | C[C@@H](Nc1ccc(NC(=O)c2snnc2C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N4OS/c1-14(15-8-6-5-7-9-15)22-16-10-12-17(13-11-16)23-20(26)18-19(21(2,3)4)24-25-27-18/h5-14,22H,1-4H3,(H,23,26)/t14-/m1/s1 |
| InChIKey | FGBWARFNLJHKCO-CQSZACIVSA-N |
| XLogP | 5.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |