C15H18BrN3OS — CID 114315653
N-[2-(1-bromoethyl)phenyl]-4-tert-butylthiadiazole-5-carboxamide (PubChem CID 114315653) has the molecular formula C15H18BrN3OS and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[2-(1-bromoethyl)phenyl]-4-tert-butylthiadiazole-5-carboxamide.
| Compound Name | N-[2-(1-bromoethyl)phenyl]-4-tert-butylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 114315653 |
| Molecular Formula | C15H18BrN3OS |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-[2-(1-bromoethyl)phenyl]-4-tert-butylthiadiazole-5-carboxamide |
| SMILES | CC(Br)c1ccccc1NC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C15H18BrN3OS/c1-9(16)10-7-5-6-8-11(10)17-14(20)12-13(15(2,3)4)18-19-21-12/h5-9H,1-4H3,(H,17,20) |
| InChIKey | LONUOWOUIVGJNX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|