C8H14N4OS — CID 65193405
N-(1-aminobutan-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 65193405) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(1-aminobutan-2-yl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65193405 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(1-aminobutan-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | CCC(CN)NC(=O)c1snnc1C |
| InChI | InChI=1S/C8H14N4OS/c1-3-6(4-9)10-8(13)7-5(2)11-12-14-7/h6H,3-4,9H2,1-2H3,(H,10,13) |
| InChIKey | KUUMUHVFQGDRJK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |