C9H15N3O2S — CID 79253100
N-(1-hydroxy-3-methylbutan-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 79253100) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 79253100 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C9H15N3O2S/c1-5(2)7(4-13)10-9(14)8-6(3)11-12-15-8/h5,7,13H,4H2,1-3H3,(H,10,14) |
| InChIKey | VAPBMLATNNHDBI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |