C8H12ClN3O2S — CID 106183126
N-(1-chloro-3-methoxypropan-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 106183126) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is N-(1-chloro-3-methoxypropan-2-yl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(1-chloro-3-methoxypropan-2-yl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106183126 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | N-(1-chloro-3-methoxypropan-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | COCC(CCl)NC(=O)c1snnc1C |
| InChI | InChI=1S/C8H12ClN3O2S/c1-5-7(15-12-11-5)8(13)10-6(3-9)4-14-2/h6H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | FQXWDPFHNXRTPI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|