C7H13N3OS — CID 130619298
(2S)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-2-ol (PubChem CID 130619298) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is (2S)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-2-ol.
| Compound Name | (2S)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 130619298 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2S)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-2-ol |
| SMILES | CC[C@H](O)CNc1nnc(C)s1 |
| InChI | InChI=1S/C7H13N3OS/c1-3-6(11)4-8-7-10-9-5(2)12-7/h6,11H,3-4H2,1-2H3,(H,8,10)/t6-/m0/s1 |
| InChIKey | RAAFAXYPJOJUOM-LURJTMIESA-N |
| XLogP | 1.03 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |