C23H24N2O3S — CID 5060578
3-amino-N-[(2,5-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfanylbenzamide (PubChem CID 5060578) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 3-amino-N-[(2,5-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfanylbenzamide.
| Compound Name | 3-amino-N-[(2,5-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 5060578 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-amino-N-[(2,5-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfanylbenzamide |
| SMILES | COc1ccc(OC)c(CNC(=O)c2ccc(Sc3ccc(C)cc3)c(N)c2)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-15-4-8-19(9-5-15)29-22-11-6-16(13-20(22)24)23(26)25-14-17-12-18(27-2)7-10-21(17)28-3/h4-13H,14,24H2,1-3H3,(H,25,26) |
| InChIKey | MFLJKWCXCNXQOA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|