C18H19BrClNO2S — CID 5179110
N-[(5-bromo-2-methoxyphenyl)methyl]-3-[(4-chlorophenyl)methylsulfanyl]propanamide (PubChem CID 5179110) has the molecular formula C18H19BrClNO2S and a molecular weight of 428.78 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-3-[(4-chlorophenyl)methylsulfanyl]propanamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-[(4-chlorophenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 5179110 |
| Molecular Formula | C18H19BrClNO2S |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-3-[(4-chlorophenyl)methylsulfanyl]propanamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)CCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19BrClNO2S/c1-23-17-7-4-15(19)10-14(17)11-21-18(22)8-9-24-12-13-2-5-16(20)6-3-13/h2-7,10H,8-9,11-12H2,1H3,(H,21,22) |
| InChIKey | DSCJBVXIVCWVNT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|