C16H12Br2F4O — CID 175031707
1-bromo-4-[1-[1-(4-bromo-2,5-difluorophenyl)ethoxy]ethyl]-2,5-difluorobenzene (PubChem CID 175031707) has the molecular formula C16H12Br2F4O and a molecular weight of 456.07 g/mol. Its IUPAC name is 1-bromo-4-[1-[1-(4-bromo-2,5-difluorophenyl)ethoxy]ethyl]-2,5-difluorobenzene.
| Compound Name | 1-bromo-4-[1-[1-(4-bromo-2,5-difluorophenyl)ethoxy]ethyl]-2,5-difluorobenzene |
|---|---|
| PubChem CID | 175031707 |
| Molecular Formula | C16H12Br2F4O |
| Molecular Weight | 456.07 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | 1-bromo-4-[1-[1-(4-bromo-2,5-difluorophenyl)ethoxy]ethyl]-2,5-difluorobenzene |
| SMILES | CC(OC(C)c1cc(F)c(Br)cc1F)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C16H12Br2F4O/c1-7(9-3-15(21)11(17)5-13(9)19)23-8(2)10-4-16(22)12(18)6-14(10)20/h3-8H,1-2H3 |
| InChIKey | UCPNZKADFXDTMZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.07 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|