C11H11Cl2F3O3 — CID 61490364
[3,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanol (PubChem CID 61490364) has the molecular formula C11H11Cl2F3O3 and a molecular weight of 319.11 g/mol. Its IUPAC name is [3,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanol.
| Compound Name | [3,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 61490364 |
| Molecular Formula | C11H11Cl2F3O3 |
| Molecular Weight | 319.11 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | [3,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanol |
| SMILES | OCc1cc(Cl)cc(Cl)c1OCCOCC(F)(F)F |
| InChI | InChI=1S/C11H11Cl2F3O3/c12-8-3-7(5-17)10(9(13)4-8)19-2-1-18-6-11(14,15)16/h3-4,17H,1-2,5-6H2 |
| InChIKey | TYTVTXZIEJJOAZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|