C10H7Cl2F3O4 — CID 106704997
3,5-dichloro-2-(2,2,2-trifluoroethoxymethoxy)benzoic acid (PubChem CID 106704997) has the molecular formula C10H7Cl2F3O4 and a molecular weight of 319.06 g/mol. Its IUPAC name is 3,5-dichloro-2-(2,2,2-trifluoroethoxymethoxy)benzoic acid.
| Compound Name | 3,5-dichloro-2-(2,2,2-trifluoroethoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 106704997 |
| Molecular Formula | C10H7Cl2F3O4 |
| Molecular Weight | 319.06 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 3,5-dichloro-2-(2,2,2-trifluoroethoxymethoxy)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1OCOCC(F)(F)F |
| InChI | InChI=1S/C10H7Cl2F3O4/c11-5-1-6(9(16)17)8(7(12)2-5)19-4-18-3-10(13,14)15/h1-2H,3-4H2,(H,16,17) |
| InChIKey | AKWBZZBQBZVDSB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|