C14H18Cl2F3NO — CID 115513158
N-[[3,5-dichloro-2-(4,4,4-trifluorobutoxy)phenyl]methyl]propan-2-amine (PubChem CID 115513158) has the molecular formula C14H18Cl2F3NO and a molecular weight of 344.20 g/mol. Its IUPAC name is N-[[3,5-dichloro-2-(4,4,4-trifluorobutoxy)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3,5-dichloro-2-(4,4,4-trifluorobutoxy)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 115513158 |
| Molecular Formula | C14H18Cl2F3NO |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[[3,5-dichloro-2-(4,4,4-trifluorobutoxy)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc(Cl)cc(Cl)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C14H18Cl2F3NO/c1-9(2)20-8-10-6-11(15)7-12(16)13(10)21-5-3-4-14(17,18)19/h6-7,9,20H,3-5,8H2,1-2H3 |
| InChIKey | KPWUNERJIYOALJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|