C30H37NO3 — CID 54783951
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[2-(3-phenylpropoxy)phenyl]pentanamide (PubChem CID 54783951) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[2-(3-phenylpropoxy)phenyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[2-(3-phenylpropoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 54783951 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-[2-(3-phenylpropoxy)phenyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccccc2OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C30H37NO3/c1-23-17-18-24(2)28(22-23)34-21-11-19-30(3,4)29(32)31-26-15-8-9-16-27(26)33-20-10-14-25-12-6-5-7-13-25/h5-9,12-13,15-18,22H,10-11,14,19-21H2,1-4H3,(H,31,32) |
| InChIKey | IDPPETXBWQOPJK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|