C27H31NO3 — CID 54783509
5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(4-phenoxyphenyl)pentanamide (PubChem CID 54783509) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(4-phenoxyphenyl)pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(4-phenoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 54783509 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2,2-dimethyl-N-(4-phenoxyphenyl)pentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H31NO3/c1-20-11-12-21(2)25(19-20)30-18-8-17-27(3,4)26(29)28-22-13-15-24(16-14-22)31-23-9-6-5-7-10-23/h5-7,9-16,19H,8,17-18H2,1-4H3,(H,28,29) |
| InChIKey | KXSSMMDMUJJCFW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|