C29H36N2O4S — CID 54783633
N-[4-[benzyl(methyl)sulfamoyl]phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (PubChem CID 54783633) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)sulfamoyl]phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide.
| Compound Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54783633 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[4-[benzyl(methyl)sulfamoyl]phenyl]-5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)Nc2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H36N2O4S/c1-22-12-13-23(2)27(20-22)35-19-9-18-29(3,4)28(32)30-25-14-16-26(17-15-25)36(33,34)31(5)21-24-10-7-6-8-11-24/h6-8,10-17,20H,9,18-19,21H2,1-5H3,(H,30,32) |
| InChIKey | GOEDXTPJAPWYLA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|