C22H35NO5 — CID 59303357
3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 59303357) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is 3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 59303357 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 3-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | Cc1ccc(C)c(OCCCC(C)(C)C(=O)OC(CC(=O)[O-])C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C22H35NO5/c1-16-9-10-17(2)19(13-16)27-12-8-11-22(3,4)21(26)28-18(14-20(24)25)15-23(5,6)7/h9-10,13,18H,8,11-12,14-15H2,1-7H3 |
| InChIKey | QHWZESMYEPNGGC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|