C19H27NO4S — CID 119210682
2-[4-[5-(2,5-dimethylphenoxy)pentanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 119210682) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[4-[5-(2,5-dimethylphenoxy)pentanoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[5-(2,5-dimethylphenoxy)pentanoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 119210682 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[4-[5-(2,5-dimethylphenoxy)pentanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)N2CCSCC2CC(=O)O)c1 |
| InChI | InChI=1S/C19H27NO4S/c1-14-6-7-15(2)17(11-14)24-9-4-3-5-18(21)20-8-10-25-13-16(20)12-19(22)23/h6-7,11,16H,3-5,8-10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | SPCIEZDLDKOGIZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|